CAS 484698-26-2 is the registry number for tert-Butyl 6,7-dimethoxy-1,4-dihydro-1,4-epiminonaphthalene-9-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4,5-dimethoxy-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-11-carboxylate (CAS 484698-26-2) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: tert-butyl 4,5-dimethoxy-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-11-carboxylate. InChIKey: JUXBVDFNWNXZMD-UHFFFAOYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | tert-butyl 4,5-dimethoxy-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-11-carboxylate |
| InChIKey | JUXBVDFNWNXZMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2C=CC1C3=CC(=C(C=C23)OC)OC |
Computed by PubChem (NCBI)