CAS 485400-41-7 appears in our catalog under these names: Methyl 2,2-dimethyl-1,3-dioxaindane-4-carboxylate, 95%, Methyl 2,2-dimethylbenzo(d)(1,3)dioxole-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl 2,2-dimethyl-1,3-benzodioxole-4-carboxylate (CAS 485400-41-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 2,2-dimethyl-1,3-benzodioxole-4-carboxylate. InChIKey: DKEDFNSUGBCDMR-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 2,2-dimethyl-1,3-benzodioxole-4-carboxylate |
| InChIKey | DKEDFNSUGBCDMR-UHFFFAOYSA-N |
| SMILES | CC1(OC2=CC=CC(=C2O1)C(=O)OC)C |
Computed by PubChem (NCBI)