CAS 485828-58-8 appears in our catalog under these names: 1-(4-bromophenyl)cyclobutane-1-carbonitrile, 95%, 1–(4–bromophenyl)cyclobutane–1–carbonitrile, 1-(4-Bromophenyl)cyclobutane-1-carbonitrile, 1-(4-Bromophenyl)cyclobutanecarbonitrile 95%, 1-(4-Bromophenyl),cyclobutanecarbonitrile, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 25g.
1-(4-bromophenyl)cyclobutane-1-carbonitrile (CAS 485828-58-8) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 1-(4-bromophenyl)cyclobutane-1-carbonitrile. InChIKey: DZWFVACFASLQKS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclobutane-1-carbonitrile |
| InChIKey | DZWFVACFASLQKS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)