CAS 486994-16-5 is the registry number for 2-(5-Bromo-4-formyl-2-methoxyphenoxy)acetamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(5-bromo-4-formyl-2-methoxyphenoxy)acetamide (CAS 486994-16-5) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: 2-(5-bromo-4-formyl-2-methoxyphenoxy)acetamide. InChIKey: QFSUBIRWCJSROI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | 2-(5-bromo-4-formyl-2-methoxyphenoxy)acetamide |
| InChIKey | QFSUBIRWCJSROI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Br)OCC(=O)N |
Computed by PubChem (NCBI)