Products 486994-79-0

CAS 486994-79-0 is the registry number for 4-(Allyloxy)-2-bromo-5-ethoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-bromo-5-ethoxy-4-prop-2-enoxybenzoic acid (CAS 486994-79-0) is a chemical compound with the molecular formula C12H13BrO4 and a molecular weight of 301.13 g/mol. IUPAC name: 2-bromo-5-ethoxy-4-prop-2-enoxybenzoic acid. InChIKey: JFRDAOFNMVESRY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BrO4
Molecular weight301.13 g/mol
IUPAC name2-bromo-5-ethoxy-4-prop-2-enoxybenzoic acid
InChIKeyJFRDAOFNMVESRY-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)C(=O)O)Br)OCC=C

Computed by PubChem (NCBI)