CAS 4872-78-0 is the registry number for (4-p-Tolyl-thiazol-2-yl)-hydrazine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazine (CAS 4872-78-0) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: [4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazine. InChIKey: TUIBEKACGWENCI-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | [4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazine |
| InChIKey | TUIBEKACGWENCI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)NN |
Computed by PubChem (NCBI)