Products 4890-85-1
CAS 4890-85-1 appears in our catalog under these names: 2-Bibenzylcarboxylic acid, 95%, 2-Bibenzylcarboxylic acid, 95+%, 2-Bibenzylcarboxylic acid, 2-Bibenzylcarboxylic acid 95%, 2-Bibenzylcarboxylic Acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 2,5g, 100g.
2-(2-phenylethyl)benzoic acid (CAS 4890-85-1) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-(2-phenylethyl)benzoic acid. InChIKey: IOHPVZBSOKLVMN-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-(2-phenylethyl)benzoic acid |
| InChIKey | IOHPVZBSOKLVMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)