CAS 497060-28-3 is the registry number for 1-(4-(tert-butyl)phenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-tert-butylphenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline (CAS 497060-28-3) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline. InChIKey: ALFGHWCZTLIFBI-UHFFFAOYSA-N.
| Molecular formula | C21H25NO2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
| InChIKey | ALFGHWCZTLIFBI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NCCC3=CC(=C(C=C32)OC)OC |
Computed by PubChem (NCBI)