CAS 497060-72-7 is the registry number for 2-(((4,4-dimethyl-2,6-dioxocyclohexylidene)methyl)amino)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide (CAS 497060-72-7) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: 2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide. InChIKey: BSDLYEJGNKSVPP-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | 2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzamide |
| InChIKey | BSDLYEJGNKSVPP-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C=NC2=CC=CC=C2C(=O)N)O)C |
Computed by PubChem (NCBI)