Products 497061-22-0
CAS 497061-22-0 is the registry number for (2,2-dimethoxyethyl)((2,4,6-trimethylphenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2,2-dimethoxyethyl)-2,4,6-trimethylbenzenesulfonamide (CAS 497061-22-0) is a chemical compound with the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. IUPAC name: N-(2,2-dimethoxyethyl)-2,4,6-trimethylbenzenesulfonamide. InChIKey: BVXYIXISRCAWDV-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4S |
|---|---|
| Molecular weight | 287.38 g/mol |
| IUPAC name | N-(2,2-dimethoxyethyl)-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | BVXYIXISRCAWDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NCC(OC)OC)C |
Computed by PubChem (NCBI)