Products 497061-25-3
CAS 497061-25-3 is the registry number for (2-(4-chloro-2-methylphenoxy)(3-pyridyl))-N-prop-2-ynylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpyridine-3-carboxamide (CAS 497061-25-3) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpyridine-3-carboxamide. InChIKey: CILHMHAXRQVQHA-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenoxy)-N-prop-2-ynylpyridine-3-carboxamide |
| InChIKey | CILHMHAXRQVQHA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC2=C(C=CC=N2)C(=O)NCC#C |
Computed by PubChem (NCBI)