CAS 49782-76-5 appears in our catalog under these names: 3-Chlorophenyl carbonochloridate, 97%, 3-Chlorophenyl chloroformate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3-chlorophenyl) carbonochloridate (CAS 49782-76-5) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. IUPAC name: (3-chlorophenyl) carbonochloridate. InChIKey: JLOMCWVILURSQX-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | (3-chlorophenyl) carbonochloridate |
| InChIKey | JLOMCWVILURSQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC(=O)Cl |
Computed by PubChem (NCBI)