Products 49809-25-8
CAS 49809-25-8 is the registry number for Cyprocide-B. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-chlorophenyl)-5-ethylsulfanyl-1,3,4-oxadiazole (CAS 49809-25-8) is a chemical compound with the molecular formula C10H9ClN2OS and a molecular weight of 240.71 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-ethylsulfanyl-1,3,4-oxadiazole. InChIKey: KNIWWUIMKUEOIZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2OS |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-ethylsulfanyl-1,3,4-oxadiazole |
| InChIKey | KNIWWUIMKUEOIZ-UHFFFAOYSA-N |
| SMILES | CCSC1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)