Products 49845-82-1
CAS 49845-82-1 is the registry number for 5-Chloro-1-methylquinazoline-2,4(1H,3H)-dione, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
5-chloro-1-methylquinazoline-2,4-dione (CAS 49845-82-1) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 5-chloro-1-methylquinazoline-2,4-dione. InChIKey: QRDPCBDIDPJSRF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 5-chloro-1-methylquinazoline-2,4-dione |
| InChIKey | QRDPCBDIDPJSRF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)Cl)C(=O)NC1=O |
Computed by PubChem (NCBI)