CAS 500-85-6 appears in our catalog under these names: 4-((4-Hydroxyphenyl)imino)cyclohexa-2,5-dien-1-one, 98%, Indophenol, 4-((4-Hydroxyphenyl)Imino)Cyclohexa-2,5-Dienone. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, Get quote.
4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one (CAS 500-85-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one. InChIKey: RSAZYXZUJROYKR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)iminocyclohexa-2,5-dien-1-one |
| InChIKey | RSAZYXZUJROYKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)