CAS 5000-44-2 appears in our catalog under these names: 1-(Phenylsulfonyl)propan-2-one 98%, 1-(Phenylsulfonyl)propan-2-one, 97%, 97%, Phenylsulfonylacetone, Phenylsulfonylacetone, 97%. Offered by: Ambeed, Chemat, GLPBio, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 100mg.
1-(benzenesulfonyl)propan-2-one (CAS 5000-44-2) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 1-(benzenesulfonyl)propan-2-one. InChIKey: YBLGSNMIIPIRFC-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 1-(benzenesulfonyl)propan-2-one |
| InChIKey | YBLGSNMIIPIRFC-UHFFFAOYSA-N |
| SMILES | CC(=O)CS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)