CAS 501902-86-9 is the registry number for 3-(5-Chloro-2-methoxyphenyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-(5-chloro-2-methoxyphenyl)-1H-pyrazol-3-amine (CAS 501902-86-9) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 5-(5-chloro-2-methoxyphenyl)-1H-pyrazol-3-amine. InChIKey: PAMBTRVKKBROAC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 5-(5-chloro-2-methoxyphenyl)-1H-pyrazol-3-amine |
| InChIKey | PAMBTRVKKBROAC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C2=CC(=NN2)N |
Computed by PubChem (NCBI)