CAS 502132-37-8 is the registry number for 3-(4-Methoxy-3-methylphenyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(4-methoxy-3-methylphenyl)-1H-pyrazol-3-amine (CAS 502132-37-8) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 5-(4-methoxy-3-methylphenyl)-1H-pyrazol-3-amine. InChIKey: XNPMMKCLCJOAAG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 5-(4-methoxy-3-methylphenyl)-1H-pyrazol-3-amine |
| InChIKey | XNPMMKCLCJOAAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=NN2)N)OC |
Computed by PubChem (NCBI)