Products 502649-07-2
CAS 502649-07-2 appears in our catalog under these names: 4-Chloro-6-ethyl-2-isopropylthieno[2,3-d]pyrimidine, 97%, 97%, 4-Chloro-6-ethyl-2-isopropylthieno[2,3-d]pyrimidine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg, 2.5g, 5g.
4-chloro-6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidine (CAS 502649-07-2) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: 4-chloro-6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidine. InChIKey: LRTKFUMTISYJHE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 4-chloro-6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidine |
| InChIKey | LRTKFUMTISYJHE-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)N=C(N=C2Cl)C(C)C |
Computed by PubChem (NCBI)