Products 50277-02-6
CAS 50277-02-6 is the registry number for Parvisoflavone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(2,4-dihydroxyphenyl)-5-hydroxy-2,2-dimethylpyrano[3,2-g]chromen-6-one (CAS 50277-02-6) is a chemical compound with the molecular formula C20H16O6 and a molecular weight of 352.3 g/mol. IUPAC name: 7-(2,4-dihydroxyphenyl)-5-hydroxy-2,2-dimethylpyrano[3,2-g]chromen-6-one. InChIKey: YKYNYMQDXOWMDT-UHFFFAOYSA-N.
| Molecular formula | C20H16O6 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 7-(2,4-dihydroxyphenyl)-5-hydroxy-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| InChIKey | YKYNYMQDXOWMDT-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=C3C(=C2O)C(=O)C(=CO3)C4=C(C=C(C=C4)O)O)C |
Computed by PubChem (NCBI)