Products 50294-51-4
CAS 50294-51-4 appears in our catalog under these names: 2-Aminoadamantane-2-carboxylic acid hydrochloride, 2-Aminoadamantane-2-carboxylic acid hydrochloride, 95%, 95%, (1R,3S,5r,7r)-2-Aminoadamantane-2-carboxylic acid hydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 5g, 100mg, 250mg.
2-aminoadamantane-2-carboxylic acid;hydrochloride (CAS 50294-51-4) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. IUPAC name: 2-aminoadamantane-2-carboxylic acid;hydrochloride. InChIKey: YANCSAPAJAELIU-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 2-aminoadamantane-2-carboxylic acid;hydrochloride |
| InChIKey | YANCSAPAJAELIU-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3(C(=O)O)N.Cl |
Computed by PubChem (NCBI)