Products 503619-25-8

CAS 503619-25-8 appears in our catalog under these names: 2-Amino-2-cyclopentylacetic acid hydrochloride, 96%, Amino-cyclopentyl-acetic acid hydrochloride, 98%, Amino-cyclopentyl-acetic acid HCl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2-amino-2-cyclopentylacetic acid;hydrochloride (CAS 503619-25-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 2-amino-2-cyclopentylacetic acid;hydrochloride. InChIKey: GMNHAZOKLXWGPB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name2-amino-2-cyclopentylacetic acid;hydrochloride
InChIKeyGMNHAZOKLXWGPB-UHFFFAOYSA-N
SMILESC1CCC(C1)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)