CAS 50454-68-7 is the registry number for Tolnidamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carboxylic acid (CAS 50454-68-7) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 300.74 g/mol. IUPAC name: 1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carboxylic acid. InChIKey: IWKDFIXLGQOEKD-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 1-[(4-chloro-2-methylphenyl)methyl]indazole-3-carboxylic acid |
| InChIKey | IWKDFIXLGQOEKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)CN2C3=CC=CC=C3C(=N2)C(=O)O |
Computed by PubChem (NCBI)