CAS 50479-11-3 appears in our catalog under these names: (3-(ETHOXYCARBONYL)PROPYL)TRIPHENYL-, (3-(Ethoxycarbonyl)propyl)triphenylphosphonium Bromide, (3–(Ethoxycarbonyl)propyl)triphenylphosphonium bromide, [3-(Ethoxycarbonyl)propyl]triphenylphosphonium Bromide, >95.0%(HPLC)(T), (4-Ethoxy-4-oxobutyl)triphenylphosphonium bromide 95%. Offered by: Sigma-Aldrich, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25G, 10g, 5g, 100g, 500g, 1g, 50g, 250g.
(4-ethoxy-4-oxobutyl)-triphenylphosphanium bromide (CAS 50479-11-3) is a chemical compound with the molecular formula C24H26BrO2P and a molecular weight of 457.3 g/mol. IUPAC name: (4-ethoxy-4-oxobutyl)-triphenylphosphanium bromide. InChIKey: JPZMNVPVVYVXAD-UHFFFAOYSA-M.
| Molecular formula | C24H26BrO2P |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | (4-ethoxy-4-oxobutyl)-triphenylphosphanium bromide |
| InChIKey | JPZMNVPVVYVXAD-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)