CAS 76235-79-5 is the registry number for 3-(1,3-dioxolan-2-yl)propyl-triphenylphosphanium bromide. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,3-dioxolan-2-yl)propyl-triphenylphosphanium bromide (CAS 76235-79-5) is a chemical compound with the molecular formula C24H26BrO2P and a molecular weight of 457.3 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)propyl-triphenylphosphanium bromide. InChIKey: CWYGOIRITCFFGT-UHFFFAOYSA-M.
| Molecular formula | C24H26BrO2P |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)propyl-triphenylphosphanium bromide |
| InChIKey | CWYGOIRITCFFGT-UHFFFAOYSA-M |
| SMILES | C1COC(O1)CCC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)