CAS 6191-70-4 appears in our catalog under these names: 4-Acetyloxybutyl-Triphenyl-Phosphonium Bromide, (4(Acetyloxy)butyl)(triphenyl)phosphonium Bromide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 500mg, 50mg.
4-acetyloxybutyl(triphenyl)phosphanium bromide (CAS 6191-70-4) is a chemical compound with the molecular formula C24H26BrO2P and a molecular weight of 457.3 g/mol. IUPAC name: 4-acetyloxybutyl(triphenyl)phosphanium bromide. InChIKey: WVBBBQKPXICVPN-UHFFFAOYSA-M.
| Molecular formula | C24H26BrO2P |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | 4-acetyloxybutyl(triphenyl)phosphanium bromide |
| InChIKey | WVBBBQKPXICVPN-UHFFFAOYSA-M |
| SMILES | CC(=O)OCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)