CAS 69891-92-5 appears in our catalog under these names: [2-(1,3-Dioxan-2-yl)ethyl]triphenylphosphonium bromide, 98%, 2–(1,3–Dioxan–2–yl)ethyltriphenylphosphonium Bromide, ¬2-(1,3-Dioxan-2-yl)ethyl|triphenylphosphonium bromide, 97% , 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium Bromide, >98.0%(T), (2-(1,3-Dioxan-2-yl)ethyl)triphenylphosphonium bromide 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium bromide (CAS 69891-92-5) is a chemical compound with the molecular formula C24H26BrO2P and a molecular weight of 457.3 g/mol. IUPAC name: 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium bromide. InChIKey: XETDBHNHTOJWPZ-UHFFFAOYSA-M.
| Molecular formula | C24H26BrO2P |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | 2-(1,3-dioxan-2-yl)ethyl-triphenylphosphanium bromide |
| InChIKey | XETDBHNHTOJWPZ-UHFFFAOYSA-M |
| SMILES | C1COC(OC1)CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)