CAS 50889-29-7 appears in our catalog under these names: (5-Carboxypentyl)triphenylphosphonium Bromide, (5–Carboxypentyl)triphenylphosphonium bromide, (5-Carboxypentyl)triphenylphosphonium bromide, 97% , (5-Carboxypentyl)triphenylphosphonium Bromide, >96.0%(T), (5-Carboxypentyl)triphenylphosphonium bromide 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 2,5g, 250mg, 100g, 25g, 500g, 1g, 5g, 0,5kg.
5-carboxypentyl(triphenyl)phosphanium bromide (CAS 50889-29-7) is a chemical compound with the molecular formula C24H26BrO2P and a molecular weight of 457.3 g/mol. IUPAC name: 5-carboxypentyl(triphenyl)phosphanium bromide. InChIKey: JUWYRPZTZSWLCY-UHFFFAOYSA-N.
| Molecular formula | C24H26BrO2P |
|---|---|
| Molecular weight | 457.3 g/mol |
| IUPAC name | 5-carboxypentyl(triphenyl)phosphanium bromide |
| InChIKey | JUWYRPZTZSWLCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[P+](CCCCCC(=O)O)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)