Products 50536-60-2
CAS 50536-60-2 is the registry number for 5-Chloro-4-methoxy-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
5-chloro-4-methoxy-1H-indole-2-carboxylic acid (CAS 50536-60-2) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 5-chloro-4-methoxy-1H-indole-2-carboxylic acid. InChIKey: IPBWQTYEIPEACB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 5-chloro-4-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | IPBWQTYEIPEACB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C=C(N2)C(=O)O)Cl |
Computed by PubChem (NCBI)