CAS 5055-39-0 appears in our catalog under these names: 1H-Indole-2-carbohydrazide, Indole-2-carbohydrazide, 97+%. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 5g, 10g.
1H-indole-2-carbohydrazide (CAS 5055-39-0) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 1H-indole-2-carbohydrazide. InChIKey: DZLFRQHFFVRYEE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 1H-indole-2-carbohydrazide |
| InChIKey | DZLFRQHFFVRYEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C(=O)NN |
Computed by PubChem (NCBI)