CAS 50634-02-1 is the registry number for 3-Benzoyl-5-hydroxy-2-phenyl-4H-1-benzopyran-4-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-benzoyl-5-hydroxy-2-phenylchromen-4-one (CAS 50634-02-1) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: 3-benzoyl-5-hydroxy-2-phenylchromen-4-one. InChIKey: IDCWYWHOWNUUJW-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 3-benzoyl-5-hydroxy-2-phenylchromen-4-one |
| InChIKey | IDCWYWHOWNUUJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(C=CC=C3O2)O)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)