CAS 5090-88-0 is the registry number for Mansonone F. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8-pentaene-10,11-dione (CAS 5090-88-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8-pentaene-10,11-dione. InChIKey: WSRLWSPFIOAYST-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8-pentaene-10,11-dione |
| InChIKey | WSRLWSPFIOAYST-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C=C1)C(=COC3=C(C(=O)C2=O)C)C |
Computed by PubChem (NCBI)