CAS 51050-54-5 appears in our catalog under these names: 3-Chloro-1H-isochromen-1-one, 95%, 3-Chloro-1H-isochromen-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-chloroisochromen-1-one (CAS 51050-54-5) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-chloroisochromen-1-one. InChIKey: ITVAVBDLYOFKIJ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chloroisochromen-1-one |
| InChIKey | ITVAVBDLYOFKIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(OC2=O)Cl |
Computed by PubChem (NCBI)