CAS 510721-85-4 appears in our catalog under these names: 2,4,9-trimethylbenzo(b)(1,8)naphthyridin-5-amine, AR03, BMH-23, AR03, 99.1%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 10mg, 50mg, 5mg, 25mg, 5 mg, 25 mg, 10 mg.
2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine (CAS 510721-85-4) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: 2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine. InChIKey: WRUVTYDQVPMYDZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 2,4,9-trimethylbenzo[b][1,8]naphthyridin-5-amine |
| InChIKey | WRUVTYDQVPMYDZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C3C(=CC(=NC3=N2)C)C)N |
Computed by PubChem (NCBI)