CAS 51132-06-0 is the registry number for 2-Chloro-1-{imidazo(1,5-a)pyridin-1-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-1-imidazo[1,5-a]pyridin-1-ylethanone (CAS 51132-06-0) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-1-imidazo[1,5-a]pyridin-1-ylethanone. InChIKey: VZKDIBCIERXEKS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-1-imidazo[1,5-a]pyridin-1-ylethanone |
| InChIKey | VZKDIBCIERXEKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=CN2C=C1)C(=O)CCl |
Computed by PubChem (NCBI)