Products 5115-65-1

CAS 5115-65-1 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-methylbutanoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid (CAS 5115-65-1) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid. InChIKey: UUIPGCXIZVZSEC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4
Molecular weight247.25 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid
InChIKeyUUIPGCXIZVZSEC-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)