CAS 5115-65-1 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-methylbutanoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid (CAS 5115-65-1) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid. InChIKey: UUIPGCXIZVZSEC-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid |
| InChIKey | UUIPGCXIZVZSEC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)