CAS 6306-54-3 appears in our catalog under these names: PHT–VAL–OH, (S)-2-(1,3-Dioxoisoindolin-2-yl)-3-methylbutanoic acid 98%, (S)-2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-3-methylbutanoic acid, 98%, 98%, (S)-2-(1,3-Dioxoisoindolin-2-yl)-3-methylbutanoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250g, 50g, 5g, 25g, 100g, 1g.
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid (CAS 6306-54-3) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid. InChIKey: UUIPGCXIZVZSEC-JTQLQIEISA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid |
| InChIKey | UUIPGCXIZVZSEC-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)