Products 51220-00-9
CAS 51220-00-9 is the registry number for (E)-3-(2-Chlorophenyl)acrylonitrile, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(E)-3-(2-chlorophenyl)prop-2-enenitrile (CAS 51220-00-9) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: (E)-3-(2-chlorophenyl)prop-2-enenitrile. InChIKey: PWWUUGALKZGDSD-HWKANZROSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (E)-3-(2-chlorophenyl)prop-2-enenitrile |
| InChIKey | PWWUUGALKZGDSD-HWKANZROSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C#N)Cl |
Computed by PubChem (NCBI)