CAS 51294-73-6 is the registry number for 4-Ethynyl-1-phenyl-1H-pyrazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-ethynyl-1-phenylpyrazole (CAS 51294-73-6) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 4-ethynyl-1-phenylpyrazole. InChIKey: SWRHXHUVZXHAGI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-ethynyl-1-phenylpyrazole |
| InChIKey | SWRHXHUVZXHAGI-UHFFFAOYSA-N |
| SMILES | C#CC1=CN(N=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)