CAS 5134-62-3 appears in our catalog under these names: 1-((4-Methylphenyl)sulfonyl)piperidine-3-carboxylic acid, 1-(Toluene-4-sulfonyl)-piperidine-3-carboxylic acid, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2g, 5g, 10g, 250mg, 1g.
1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid (CAS 5134-62-3) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid. InChIKey: IZPMTGWZPCZFNW-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | IZPMTGWZPCZFNW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCCC(C2)C(=O)O |
Computed by PubChem (NCBI)