CAS 5138-52-3 is the registry number for methyl naphthalene-1-sulfonate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 2g, 5g, 10g.
Methyl naphthalene-1-sulfonate (CAS 5138-52-3) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: methyl naphthalene-1-sulfonate. InChIKey: QUFIXTQDTDCCLJ-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl naphthalene-1-sulfonate |
| InChIKey | QUFIXTQDTDCCLJ-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)