CAS 5138-53-4 is the registry number for methyl naphthalene-2-sulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl naphthalene-2-sulfonate (CAS 5138-53-4) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: methyl naphthalene-2-sulfonate. InChIKey: AFVPRVLDAPXRCX-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl naphthalene-2-sulfonate |
| InChIKey | AFVPRVLDAPXRCX-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)