Products 51413-71-9
CAS 51413-71-9 appears in our catalog under these names: 6-Methoxy-2-methylquinazolin-4-ol, 95%, 6-Methoxy-2-methylquinazolin-4-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g.
6-methoxy-2-methyl-3H-quinazolin-4-one (CAS 51413-71-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-methoxy-2-methyl-3H-quinazolin-4-one. InChIKey: JOGHWTUPCJOYMF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-methoxy-2-methyl-3H-quinazolin-4-one |
| InChIKey | JOGHWTUPCJOYMF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)OC)C(=O)N1 |
Computed by PubChem (NCBI)