CAS 514200-90-9 is the registry number for N-(Furan-2-ylmethyl)-1-methyl-4-nitro-1H-imidazol-5-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-(furan-2-ylmethyl)-3-methyl-5-nitroimidazol-4-amine (CAS 514200-90-9) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: N-(furan-2-ylmethyl)-3-methyl-5-nitroimidazol-4-amine. InChIKey: XAEUCUPZXDUBEV-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-3-methyl-5-nitroimidazol-4-amine |
| InChIKey | XAEUCUPZXDUBEV-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1NCC2=CC=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)