Products 514798-00-6
CAS 514798-00-6 is the registry number for 2,5-Dichloro-3-fluoroisonicotinic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,5-dichloro-3-fluoropyridine-4-carboxylic acid (CAS 514798-00-6) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 2,5-dichloro-3-fluoropyridine-4-carboxylic acid. InChIKey: XXKZEJNVNFYDAP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 2,5-dichloro-3-fluoropyridine-4-carboxylic acid |
| InChIKey | XXKZEJNVNFYDAP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)F)C(=O)O)Cl |
Computed by PubChem (NCBI)