Products 51542-42-8
CAS 51542-42-8 is the registry number for Methyl 4-(5-amino-1,3,4-thiadiazol-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-(5-amino-1,3,4-thiadiazol-2-yl)benzoate (CAS 51542-42-8) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: methyl 4-(5-amino-1,3,4-thiadiazol-2-yl)benzoate. InChIKey: FFWNJSLCIGAQEI-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | methyl 4-(5-amino-1,3,4-thiadiazol-2-yl)benzoate |
| InChIKey | FFWNJSLCIGAQEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)