CAS 733795-49-8 appears in our catalog under these names: 2-[(4H-1,2,4-Triazol-3-ylthio)methyl]benzoic acid, 95%, 2-(((4H-1,2,4-Triazol-3-yl)thio)methyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoic acid (CAS 733795-49-8) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoic acid. InChIKey: JVHKRPSXLPNVSP-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoic acid |
| InChIKey | JVHKRPSXLPNVSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=NC=NN2)C(=O)O |
Computed by PubChem (NCBI)