Products 1104276-25-6
CAS 1104276-25-6 appears in our catalog under these names: 4-Ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid, 95%, 4-Ethyl-2-(pyrimidin-2-yl)thiazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 1104276-25-6) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: OZPQEAZOQIDRRL-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | OZPQEAZOQIDRRL-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=N1)C2=NC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)