CAS 77803-44-2 appears in our catalog under these names: 5-(1,3-Benzodioxol-5-yl)-4-methyl-4h-1,2,4-triazole-3-thiol, 95%, 5-(Benzo(d)(1,3)dioxol-5-yl)-4-methyl-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(1,3-benzodioxol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 77803-44-2) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: LZMYGUFGSQKVLM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | LZMYGUFGSQKVLM-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)