Products 185034-18-8

CAS 185034-18-8 is the registry number for (3-Phenyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid (CAS 185034-18-8) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid. InChIKey: LLSYGKQHAYFNCR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9N3O2S
Molecular weight235.26 g/mol
IUPAC name2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid
InChIKeyLLSYGKQHAYFNCR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NNC(=S)N2CC(=O)O

Computed by PubChem (NCBI)