CAS 185034-18-8 is the registry number for (3-Phenyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid (CAS 185034-18-8) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid. InChIKey: LLSYGKQHAYFNCR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid |
| InChIKey | LLSYGKQHAYFNCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)N2CC(=O)O |
Computed by PubChem (NCBI)